CAS 73557-61-6 appears in our catalog under these names: 1,3,4-Tribromo-2,5-dichlorobenzene, 95%, 1,3,4-Tribromo-2,5-dichlorobenzene, 97%, 1,3,4–Tribromo–2,5–dichlorobenzene. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,3,4-tribromo-2,5-dichlorobenzene (CAS 73557-61-6) is a chemical compound with the molecular formula C6HBr3Cl2 and a molecular weight of 383.69 g/mol. IUPAC name: 1,3,4-tribromo-2,5-dichlorobenzene. InChIKey: VMDXHIDUWUOGDU-UHFFFAOYSA-N.
| Molecular formula | C6HBr3Cl2 |
|---|---|
| Molecular weight | 383.69 g/mol |
| IUPAC name | 1,3,4-tribromo-2,5-dichlorobenzene |
| InChIKey | VMDXHIDUWUOGDU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Br)Br)Cl |
Computed by PubChem (NCBI)