CAS 7356-41-4 appears in our catalog under these names: 2-(2,5-Dimethylphenoxy)acetic acid 95%, 2-(2,5-dimethylphenoxy)acetic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 5g, 25g.
2-(2,5-dimethylphenoxy)acetic acid (CAS 7356-41-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(2,5-dimethylphenoxy)acetic acid. InChIKey: RSJMMLSDGNQOEO-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(2,5-dimethylphenoxy)acetic acid |
| InChIKey | RSJMMLSDGNQOEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCC(=O)O |
Computed by PubChem (NCBI)