Products 7357-41-7

CAS 7357-41-7 is the registry number for Diphenyl Sulfone-3,3'-disulfonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 10g, 50g, 25g.

Structural formula: {0} (CAS {1})

3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride (CAS 7357-41-7) is a chemical compound with the molecular formula C12H8Cl2O6S3 and a molecular weight of 415.3 g/mol. IUPAC name: 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride. InChIKey: JCIFZSCARAOKME-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O6S3
Molecular weight415.3 g/mol
IUPAC name3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride
InChIKeyJCIFZSCARAOKME-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)S(=O)(=O)C2=CC(=CC=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)