CAS 73590-92-8 is the registry number for 4,6-Dimethyl-1,3-dihydro-2h-benzimidazole-2-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4,6-dimethyl-1,3-dihydrobenzimidazole-2-thione (CAS 73590-92-8) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: 4,6-dimethyl-1,3-dihydrobenzimidazole-2-thione. InChIKey: PJALJAICIIMXNO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | 4,6-dimethyl-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | PJALJAICIIMXNO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)NC(=S)N2)C |
Computed by PubChem (NCBI)