CAS 736-53-8 appears in our catalog under these names: Nifuratel Impurity 2, Nifuratel Impurity 39 (5-Nitrofuraldazine), 5-Nitro-2-furaldehydeazine, 98%, 98%, 5-nitro-2-furaldehyde azine, 98%. Offered by: Hubei YoungXin, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
1-(5-nitrofuran-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]methanimine (CAS 736-53-8) is a chemical compound with the molecular formula C10H6N4O6 and a molecular weight of 278.18 g/mol. IUPAC name: 1-(5-nitrofuran-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]methanimine. InChIKey: LIELVKLOFLWIGJ-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O6 |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | 1-(5-nitrofuran-2-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]methanimine |
| InChIKey | LIELVKLOFLWIGJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C=NN=CC2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)