Products 73607-83-7
CAS 73607-83-7 appears in our catalog under these names: Butanoic-d7 Acid, >95% (GC), Butyric-d7 Acid, 98 atom % D, min 98% Chemical Purity, Butyric Acid–d7, D7-Butyric acid, ISO 17034 RM, Butyric-D7 acid, >=98 atom % D, >=98% CP. Offered by: TRC, CDN, GLPBio, HPC Standards, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 5g, 250mg, 50mg.
2,2,3,3,4,4,4-heptadeuteriobutanoic acid (CAS 73607-83-7) is a chemical compound with the molecular formula C4H8O2 and a molecular weight of 95.15 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptadeuteriobutanoic acid. InChIKey: FERIUCNNQQJTOY-NCKGIQLSSA-N.
| Molecular formula | C4H8O2 |
|---|---|
| Molecular weight | 95.15 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptadeuteriobutanoic acid |
| InChIKey | FERIUCNNQQJTOY-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)