Products 736108-96-6

CAS 736108-96-6 is the registry number for Tiotropium Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate (CAS 736108-96-6) is a chemical compound with the molecular formula C18H19NO3S2 and a molecular weight of 361.5 g/mol. IUPAC name: (8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate. InChIKey: WUOOUIFCFAXEKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO3S2
Molecular weight361.5 g/mol
IUPAC name(8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate
InChIKeyWUOOUIFCFAXEKJ-UHFFFAOYSA-N
SMILESCN1C2CC(CC1C=C2)OC(=O)C(C3=CC=CS3)(C4=CC=CS4)O

Computed by PubChem (NCBI)