CAS 736162-74-6 is the registry number for 5-(2-Bromophenyl)-4-(3,4-dichlorophenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(2-bromophenyl)-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione (CAS 736162-74-6) is a chemical compound with the molecular formula C14H8BrCl2N3S and a molecular weight of 401.1 g/mol. IUPAC name: 3-(2-bromophenyl)-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: IWWIXUFEDSMKOV-UHFFFAOYSA-N.
| Molecular formula | C14H8BrCl2N3S |
|---|---|
| Molecular weight | 401.1 g/mol |
| IUPAC name | 3-(2-bromophenyl)-4-(3,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | IWWIXUFEDSMKOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)N2C3=CC(=C(C=C3)Cl)Cl)Br |
Computed by PubChem (NCBI)