CAS 73624-47-2 appears in our catalog under these names: R–Alpine–Borane, R-ALPINE-BORANE (0.5M SOLN. IN THF). Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 25ml, 100ML.
9-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane (CAS 73624-47-2) is a chemical compound with the molecular formula C18H31B and a molecular weight of 258.3 g/mol. IUPAC name: 9-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane. InChIKey: VCDGSBJCRYTLNU-CJGYBVCLSA-N.
| Molecular formula | C18H31B |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 9-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-9-borabicyclo[3.3.1]nonane |
| InChIKey | VCDGSBJCRYTLNU-CJGYBVCLSA-N |
| SMILES | B1(C2CCCC1CCC2)[C@@H]3C[C@@H]4C[C@H]([C@H]3C)C4(C)C |
Computed by PubChem (NCBI)