Products 73625-62-4
CAS 73625-62-4 appears in our catalog under these names: (+/-)-Quinpirole Dihydrochloride, rel-Quinpirole (dihydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5g, Get quote.
(4aS,8aS)-5-propyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline;dihydrochloride (CAS 73625-62-4) is a chemical compound with the molecular formula C13H23Cl2N3 and a molecular weight of 292.2 g/mol. IUPAC name: (4aS,8aS)-5-propyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline;dihydrochloride. InChIKey: GJIGRGIGKHPYTK-LWCZFAHISA-N.
| Molecular formula | C13H23Cl2N3 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | (4aS,8aS)-5-propyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline;dihydrochloride |
| InChIKey | GJIGRGIGKHPYTK-LWCZFAHISA-N |
| SMILES | CCCN1CCC[C@@H]2[C@@H]1CC3=C(C2)NN=C3.Cl.Cl |
Computed by PubChem (NCBI)