CAS 73654-97-4 is the registry number for NSC 122393/ 100%. Offered by: TargetMol. Available pack sizes: 1mg, 5mg.
4,5,6,7-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 73654-97-4) is a chemical compound with the molecular formula C20H8Br4O5 and a molecular weight of 647.9 g/mol. IUPAC name: 4,5,6,7-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: YAKUQPDPOFENQR-UHFFFAOYSA-N.
| Molecular formula | C20H8Br4O5 |
|---|---|
| Molecular weight | 647.9 g/mol |
| IUPAC name | 4,5,6,7-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | YAKUQPDPOFENQR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=C(C24C5=C(C(=C(C(=C5Br)Br)Br)Br)C(=O)O4)C=CC(=C3)O |
Computed by PubChem (NCBI)