Products 73679-54-6
CAS 73679-54-6 is the registry number for [(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol (CAS 73679-54-6) is a chemical compound with the molecular formula C7H14O3 and a molecular weight of 146.18 g/mol. IUPAC name: [(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: VWUQFWPEGNZUQV-PHDIDXHHSA-N.
| Molecular formula | C7H14O3 |
|---|---|
| Molecular weight | 146.18 g/mol |
| IUPAC name | [(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | VWUQFWPEGNZUQV-PHDIDXHHSA-N |
| SMILES | C[C@@H]1[C@H](OC(O1)(C)C)CO |
Computed by PubChem (NCBI)