CAS 7369-50-8 appears in our catalog under these names: 1-Ethyl-3-nitrobenzene, 95%, 1–Ethyl–3–nitrobenzene, 1-Ethyl-3-nitrobenzene 95%, 1-Ethyl-3-nitrobenzene, ≥95%, ≥95%, 1-Ethyl-3-nitrobenzene, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
1-ethyl-3-nitrobenzene (CAS 7369-50-8) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 1-ethyl-3-nitrobenzene. InChIKey: RXAKLPGKSXJZEF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 1-ethyl-3-nitrobenzene |
| InChIKey | RXAKLPGKSXJZEF-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)