CAS 7370-58-3 appears in our catalog under these names: 3,3'-Diselenobispropionic Acid, 3,3'-Diselanediyldipropanoic acid 80%, Diselenodipropionic acid, 80%, 80%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
3-(2-carboxyethyldiselanyl)propanoic acid (CAS 7370-58-3) is a chemical compound with the molecular formula C6H10O4Se2 and a molecular weight of 304.08 g/mol. IUPAC name: 3-(2-carboxyethyldiselanyl)propanoic acid. InChIKey: AXJLEYVRLPNPGF-UHFFFAOYSA-N.
| Molecular formula | C6H10O4Se2 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | 3-(2-carboxyethyldiselanyl)propanoic acid |
| InChIKey | AXJLEYVRLPNPGF-UHFFFAOYSA-N |
| SMILES | C(C[Se][Se]CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)