CAS 73718-26-0 is the registry number for 3-(phenylmethylthio)-1,2,4-triazino(5,6-b)indole. Offered by: Biosynth. Available pack sizes: 250mg.
3-benzylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole (CAS 73718-26-0) is a chemical compound with the molecular formula C16H12N4S and a molecular weight of 292.4 g/mol. IUPAC name: 3-benzylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole. InChIKey: WBVHPGIBBFVLKN-UHFFFAOYSA-N.
| Molecular formula | C16H12N4S |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 3-benzylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole |
| InChIKey | WBVHPGIBBFVLKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC3=C(C4=CC=CC=C4N3)N=N2 |
Computed by PubChem (NCBI)