CAS 737708-41-7 is the registry number for 4-(4-(4-Fluorophenyl)thiazol-2-yl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]aniline (CAS 737708-41-7) is a chemical compound with the molecular formula C15H11FN2S and a molecular weight of 270.3 g/mol. IUPAC name: 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]aniline. InChIKey: WZWMNEQQRMTUGF-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2S |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]aniline |
| InChIKey | WZWMNEQQRMTUGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)