CAS 73771-03-6 is the registry number for Mianserin impurity-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-N-(2-chloro-2-phenylethyl)-N-methyl-2-phenylethanamine;hydrochloride (CAS 73771-03-6) is a chemical compound with the molecular formula C17H20Cl3N and a molecular weight of 344.7 g/mol. IUPAC name: 2-chloro-N-(2-chloro-2-phenylethyl)-N-methyl-2-phenylethanamine;hydrochloride. InChIKey: INFKDABQXOERKF-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl3N |
|---|---|
| Molecular weight | 344.7 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-2-phenylethyl)-N-methyl-2-phenylethanamine;hydrochloride |
| InChIKey | INFKDABQXOERKF-UHFFFAOYSA-N |
| SMILES | CN(CC(C1=CC=CC=C1)Cl)CC(C2=CC=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)