Products 737755-14-5
CAS 737755-14-5 appears in our catalog under these names: Atorvastatin Impurity 91, Atorvastatin Impurity 134. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl (3R,5R)-7-amino-3,5-dihydroxyheptanoate (CAS 737755-14-5) is a chemical compound with the molecular formula C11H23NO4 and a molecular weight of 233.30 g/mol. IUPAC name: tert-butyl (3R,5R)-7-amino-3,5-dihydroxyheptanoate. InChIKey: YKGLSINPESBOPU-RKDXNWHRSA-N.
| Molecular formula | C11H23NO4 |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | tert-butyl (3R,5R)-7-amino-3,5-dihydroxyheptanoate |
| InChIKey | YKGLSINPESBOPU-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C[C@@H](CCN)O)O |
Computed by PubChem (NCBI)