CAS 73785-43-0 appears in our catalog under these names: 6-Carboxyhexylphosphocholine p-nitrophenyl ester, 98%, 6-Carboxyhexylphosphocholine p-Nitrophenyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
[6-(4-nitrophenoxy)-6-oxohexyl] 2-(trimethylazaniumyl)ethyl phosphate (CAS 73785-43-0) is a chemical compound with the molecular formula C17H27N2O8P and a molecular weight of 418.4 g/mol. IUPAC name: [6-(4-nitrophenoxy)-6-oxohexyl] 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: QTQKYDHSYAZAJN-UHFFFAOYSA-N.
| Molecular formula | C17H27N2O8P |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | [6-(4-nitrophenoxy)-6-oxohexyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChIKey | QTQKYDHSYAZAJN-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)