CAS 73800-97-2 is the registry number for DL-Glutaryl Carnitine Chloride. Offered by: Chemat Brand. Available pack sizes: on request.
[3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium chloride (CAS 73800-97-2) is a chemical compound with the molecular formula C12H22ClNO6 and a molecular weight of 311.76 g/mol. IUPAC name: [3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium chloride. InChIKey: RKBZRCSKOSLNQQ-UHFFFAOYSA-N.
| Molecular formula | C12H22ClNO6 |
|---|---|
| Molecular weight | 311.76 g/mol |
| IUPAC name | [3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium chloride |
| InChIKey | RKBZRCSKOSLNQQ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CCCC(=O)O.[Cl-] |
Computed by PubChem (NCBI)