Products 73801-31-7

CAS 73801-31-7 is the registry number for L-Leucine 3-carboxy-4-hydroxy anilide hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-hydroxybenzoic acid;hydrochloride (CAS 73801-31-7) is a chemical compound with the molecular formula C13H19ClN2O4 and a molecular weight of 302.75 g/mol. IUPAC name: 5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-hydroxybenzoic acid;hydrochloride. InChIKey: BSVJWFHAORBGDY-PPHPATTJSA-N.

Identity
Molecular formulaC13H19ClN2O4
Molecular weight302.75 g/mol
IUPAC name5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-hydroxybenzoic acid;hydrochloride
InChIKeyBSVJWFHAORBGDY-PPHPATTJSA-N
SMILESCC(C)C[C@@H](C(=O)NC1=CC(=C(C=C1)O)C(=O)O)N.Cl

Computed by PubChem (NCBI)