CAS 73825-95-3 appears in our catalog under these names: 2,2'-(2-Hydroxypropane-1,3-diyl)bis(1h-isoindole-1,3(2h)-dione), 95%, Rivaroxaban Impurity 149, Linezolid Impurity 71, 2,2'-(2-Hydroxypropane-1,3-diyl)bis(1H-isoindole-1,3(2H)-dione), >95% (HPLC), 2,2'–(2–Hydroxypropane–1,3–diyl)bis(isoindoline–1,3–dione). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: 1g, 5g, on request, 10g, 250mg.
2-[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]isoindole-1,3-dione (CAS 73825-95-3) is a chemical compound with the molecular formula C19H14N2O5 and a molecular weight of 350.3 g/mol. IUPAC name: 2-[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]isoindole-1,3-dione. InChIKey: PAMYSJPCAPDCNZ-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O5 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 2-[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]isoindole-1,3-dione |
| InChIKey | PAMYSJPCAPDCNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)