CAS 7385-90-2 appears in our catalog under these names: 5,7-Diiodo-2-methylquinolin-8-ol, 95%, 5,7-Diiodo-2-methylquinolin-8-ol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5,7-diiodo-2-methylquinolin-8-ol (CAS 7385-90-2) is a chemical compound with the molecular formula C10H7I2NO and a molecular weight of 410.98 g/mol. IUPAC name: 5,7-diiodo-2-methylquinolin-8-ol. InChIKey: MLLYGURMTANGMK-UHFFFAOYSA-N.
| Molecular formula | C10H7I2NO |
|---|---|
| Molecular weight | 410.98 g/mol |
| IUPAC name | 5,7-diiodo-2-methylquinolin-8-ol |
| InChIKey | MLLYGURMTANGMK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2O)I)I |
Computed by PubChem (NCBI)