CAS 738606-44-5 appears in our catalog under these names: Bempedoic Acid Impurity 14, Bempedoic acid Impurity 3, Diethyl 8-isocyano-2,2,14,14-tetramethyl-8-tosylpentadecanedioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 8-isocyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate (CAS 738606-44-5) is a chemical compound with the molecular formula C31H49NO6S and a molecular weight of 563.8 g/mol. IUPAC name: diethyl 8-isocyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate. InChIKey: UZZLDIFAUXUEAY-UHFFFAOYSA-N.
| Molecular formula | C31H49NO6S |
|---|---|
| Molecular weight | 563.8 g/mol |
| IUPAC name | diethyl 8-isocyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate |
| InChIKey | UZZLDIFAUXUEAY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCC)([N+]#[C-])S(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)