Products 73861-92-4
CAS 73861-92-4 is the registry number for 1,6-Dideoxynojirimycin. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg.
(2R,3R,4R,5S)-2-methylpiperidine-3,4,5-triol (CAS 73861-92-4) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2R,3R,4R,5S)-2-methylpiperidine-3,4,5-triol. InChIKey: VYOCYWDJTQRZLC-JGWLITMVSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-methylpiperidine-3,4,5-triol |
| InChIKey | VYOCYWDJTQRZLC-JGWLITMVSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H](CN1)O)O)O |
Computed by PubChem (NCBI)