Products 73917-84-7

CAS 73917-84-7 is the registry number for Selegiline EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-amino-2-phenylbutan-2-ol (CAS 73917-84-7) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 3-amino-2-phenylbutan-2-ol. InChIKey: XWXGOKGZVMEGGA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO
Molecular weight165.23 g/mol
IUPAC name3-amino-2-phenylbutan-2-ol
InChIKeyXWXGOKGZVMEGGA-UHFFFAOYSA-N
SMILESCC(C(C)(C1=CC=CC=C1)O)N

Computed by PubChem (NCBI)