CAS 73927-07-8 appears in our catalog under these names: BIS(P-IODOPHENYL) SULFIDE, ≥95%, ≥95%, Bis(p-iodophenyl) sulfide, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-iodo-4-(4-iodophenyl)sulfanylbenzene (CAS 73927-07-8) is a chemical compound with the molecular formula C12H8I2S and a molecular weight of 438.07 g/mol. IUPAC name: 1-iodo-4-(4-iodophenyl)sulfanylbenzene. InChIKey: DUVVOUSAQUQNMU-UHFFFAOYSA-N.
| Molecular formula | C12H8I2S |
|---|---|
| Molecular weight | 438.07 g/mol |
| IUPAC name | 1-iodo-4-(4-iodophenyl)sulfanylbenzene |
| InChIKey | DUVVOUSAQUQNMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SC2=CC=C(C=C2)I)I |
Computed by PubChem (NCBI)