CAS 739317-34-1 is the registry number for 5,7-Diamino-1,3-dihydroindol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5,7-diamino-1,3-dihydroindol-2-one (CAS 739317-34-1) is a chemical compound with the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. IUPAC name: 5,7-diamino-1,3-dihydroindol-2-one. InChIKey: UVCWNAFOWGAFEF-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O |
|---|---|
| Molecular weight | 163.18 g/mol |
| IUPAC name | 5,7-diamino-1,3-dihydroindol-2-one |
| InChIKey | UVCWNAFOWGAFEF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)N)N)NC1=O |
Computed by PubChem (NCBI)