Products 7397-06-0
CAS 7397-06-0 appears in our catalog under these names: 4–tert–Butyl–o–xylene, 4-tert-Butyl-o-xylene, >98.0%(GC), 4-tert-Butyl-o-xylene 99+%, 4-TERT-BUTYL-O-XYLENE, 99+%, 99+%, 4-(tert-Butyl)-1,2-dimethylbenzene, 99+%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g.
4-tert-butyl-1,2-dimethylbenzene (CAS 7397-06-0) is a chemical compound with the molecular formula C12H18 and a molecular weight of 162.27 g/mol. IUPAC name: 4-tert-butyl-1,2-dimethylbenzene. InChIKey: QRPPSTNABSMSCS-UHFFFAOYSA-N.
| Molecular formula | C12H18 |
|---|---|
| Molecular weight | 162.27 g/mol |
| IUPAC name | 4-tert-butyl-1,2-dimethylbenzene |
| InChIKey | QRPPSTNABSMSCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
Benzene, 4-(1,1-dimethylethyl)-1,2-dimethyl-, 4-tert-Butyl-o-xylene, 4-tert-Butyl-1,2-dimethylbenzene, 4-(tert-butyl)-1,2-dimethylbenzene, 4-t-Butyl-o-xylene, 1,2-Dimethyl-4-tert-butylbenzene, 4-tert-butyl-1,2-dimethyl-benzene, 4-tert-Butyl-o-xylene, 99%, 1-tert-Butyl-3,4-dimethylbenzene, butylxylene