CAS 73991-95-4 appears in our catalog under these names: ((4S)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic Acid, >95% (HPLC), (S)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic acid, 98%, 98%, ((4S)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic, 98%, (S)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic acid, 95%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g, 100g.
2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetic acid (CAS 73991-95-4) is a chemical compound with the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. IUPAC name: 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetic acid. InChIKey: IDQOCLIWDMZKBZ-BYPYZUCNSA-N.
| Molecular formula | C7H10O5 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetic acid |
| InChIKey | IDQOCLIWDMZKBZ-BYPYZUCNSA-N |
| SMILES | CC1(O[C@H](C(=O)O1)CC(=O)O)C |
Computed by PubChem (NCBI)