CAS 7400-11-5 appears in our catalog under these names: (+)–Lupanine (perchlorate), (+)-Lupanine perchlorate, >95% (HPLC), Lupanine perchlorate, Lupanine (perchlorate). Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 2,5mg, 0,5mg, 1 mg.
(1S,2R,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one;perchloric acid (CAS 7400-11-5) is a chemical compound with the molecular formula C15H25ClN2O5 and a molecular weight of 348.82 g/mol. IUPAC name: (1S,2R,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one;perchloric acid. InChIKey: DVZQTPMQQXAHSQ-BHARVXRSSA-N.
| Molecular formula | C15H25ClN2O5 |
|---|---|
| Molecular weight | 348.82 g/mol |
| IUPAC name | (1S,2R,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one;perchloric acid |
| InChIKey | DVZQTPMQQXAHSQ-BHARVXRSSA-N |
| SMILES | C1CCN2C[C@@H]3C[C@@H]([C@@H]2C1)CN4[C@@H]3CCCC4=O.OCl(=O)(=O)=O |
Computed by PubChem (NCBI)