CAS 7403-46-5 appears in our catalog under these names: 2–Chloro–1–methylpyridinium p–Toluenesulfonate, 2-Chloro-1-methylpyridinium p-Toluenesulfonate, >98.0%(T), 2-Chloro-1-methylpyridinium p-toluenosulfonate 98%, 2-Chloro-1-methylpyridinium p-Toluenesulfonate, 98%, 98%, 2-Chloro-1-methylpyridin-1-ium 4-methylbenzenesulfonate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 10g.
2-chloro-1-methylpyridin-1-ium;4-methylbenzenesulfonate (CAS 7403-46-5) is a chemical compound with the molecular formula C13H14ClNO3S and a molecular weight of 299.77 g/mol. IUPAC name: 2-chloro-1-methylpyridin-1-ium;4-methylbenzenesulfonate. InChIKey: KWNGIKVZXFFZNN-UHFFFAOYSA-M.
| Molecular formula | C13H14ClNO3S |
|---|---|
| Molecular weight | 299.77 g/mol |
| IUPAC name | 2-chloro-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
| InChIKey | KWNGIKVZXFFZNN-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1Cl |
Computed by PubChem (NCBI)