CAS 740841-15-0 appears in our catalog under these names: GSK-3 Inhibitor X - CAS 740841-15-0 - Calbiochem, 95%, (E/Z)-BIO-acetoxime, GSK-3 Inhibitor X, GSK-3 Inhibitor X 1PC X 1MG, (E/Z)-BIO-acetoxime, 99.0%. Offered by: Chemat Brand, TargetMol, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 25mg, 50mg, 1 mg.
[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] acetate (CAS 740841-15-0) is a chemical compound with the molecular formula C18H12BrN3O3 and a molecular weight of 398.2 g/mol. IUPAC name: [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] acetate. InChIKey: HUDSYNWJCPDHLL-CJLVFECKSA-N.
| Molecular formula | C18H12BrN3O3 |
|---|---|
| Molecular weight | 398.2 g/mol |
| IUPAC name | [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] acetate |
| InChIKey | HUDSYNWJCPDHLL-CJLVFECKSA-N |
| SMILES | CC(=O)O/N=C/1\C2=CC=CC=C2N=C1C3=C(NC4=C3C=CC(=C4)Br)O |
Computed by PubChem (NCBI)