CAS 74086-23-0 appears in our catalog under these names: Boc-d-gln-onp, 95%, Boc–D–Gln–ONp, Boc-D-Gln-ONp 95%, 4-Nitrophenyl (tert-butoxycarbonyl)-D-glutaminate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(4-nitrophenyl) (2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CAS 74086-23-0) is a chemical compound with the molecular formula C16H21N3O7 and a molecular weight of 367.35 g/mol. IUPAC name: (4-nitrophenyl) (2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate. InChIKey: HJMMCTZLXOVMFB-GFCCVEGCSA-N.
| Molecular formula | C16H21N3O7 |
|---|---|
| Molecular weight | 367.35 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| InChIKey | HJMMCTZLXOVMFB-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)N)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)