CAS 74094-05-6 appears in our catalog under these names: D–Lactic acid–benzyl ester, (R)-Benzyl 2-hydroxypropanoate 98%, Benzyl (R)-2-Hydroxypropanoate, 98%, 98%, Benzyl (R)-2-hydroxypropanoate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g, 50g, 100g.
Benzyl (2R)-2-hydroxypropanoate (CAS 74094-05-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: benzyl (2R)-2-hydroxypropanoate. InChIKey: ZYTLPUIDJRKAAM-MRVPVSSYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | benzyl (2R)-2-hydroxypropanoate |
| InChIKey | ZYTLPUIDJRKAAM-MRVPVSSYSA-N |
| SMILES | C[C@H](C(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)