Products 74129-03-6
CAS 74129-03-6 is the registry number for Tebuquine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-[(7-chloroquinolin-4-yl)amino]phenol (CAS 74129-03-6) is a chemical compound with the molecular formula C26H25Cl2N3O and a molecular weight of 466.4 g/mol. IUPAC name: 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-[(7-chloroquinolin-4-yl)amino]phenol. InChIKey: BCHMRNALCJISMZ-UHFFFAOYSA-N.
| Molecular formula | C26H25Cl2N3O |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-[(7-chloroquinolin-4-yl)amino]phenol |
| InChIKey | BCHMRNALCJISMZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=C(C(=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)