CAS 74131-08-1 is the registry number for Brivudine Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(E)-2-chloroethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 74131-08-1) is a chemical compound with the molecular formula C11H13ClN2O5 and a molecular weight of 288.68 g/mol. IUPAC name: 5-[(E)-2-chloroethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: LKILSWTYYBIIQE-PIXDULNESA-N.
| Molecular formula | C11H13ClN2O5 |
|---|---|
| Molecular weight | 288.68 g/mol |
| IUPAC name | 5-[(E)-2-chloroethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | LKILSWTYYBIIQE-PIXDULNESA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)/C=C/Cl)CO)O |
Computed by PubChem (NCBI)