CAS 74144-43-7 appears in our catalog under these names: 6-Benzoyl-2-naphthyl phosphate disodium salt, 95%, 6-Benzoyl-2-naphthylphosphate disodium salt. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
Disodium;(6-benzoylnaphthalen-2-yl) phosphate (CAS 74144-43-7) is a chemical compound with the molecular formula C17H11Na2O5P and a molecular weight of 372.22 g/mol. IUPAC name: disodium;(6-benzoylnaphthalen-2-yl) phosphate. InChIKey: GVJVEXGBJIDSOX-UHFFFAOYSA-L.
| Molecular formula | C17H11Na2O5P |
|---|---|
| Molecular weight | 372.22 g/mol |
| IUPAC name | disodium;(6-benzoylnaphthalen-2-yl) phosphate |
| InChIKey | GVJVEXGBJIDSOX-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)C=C(C=C3)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)