Products 74159-77-6
CAS 74159-77-6 is the registry number for 4-(4-Chlorophenoxy)-2-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-(4-chlorophenoxy)-2-(trifluoromethyl)aniline (CAS 74159-77-6) is a chemical compound with the molecular formula C13H9ClF3NO and a molecular weight of 287.66 g/mol. IUPAC name: 4-(4-chlorophenoxy)-2-(trifluoromethyl)aniline. InChIKey: MJDSHTMEOISRNB-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3NO |
|---|---|
| Molecular weight | 287.66 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)-2-(trifluoromethyl)aniline |
| InChIKey | MJDSHTMEOISRNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)N)C(F)(F)F)Cl |
Computed by PubChem (NCBI)