Products 74163-10-3
CAS 74163-10-3 is the registry number for 11-Thiohomoaminopterin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoyl]amino]pentanedioic acid (CAS 74163-10-3) is a chemical compound with the molecular formula C20H21N7O5S and a molecular weight of 471.5 g/mol. IUPAC name: (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoyl]amino]pentanedioic acid. InChIKey: FXGBKUVTNNFJHR-ZDUSSCGKSA-N.
| Molecular formula | C20H21N7O5S |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoyl]amino]pentanedioic acid |
| InChIKey | FXGBKUVTNNFJHR-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)SCCC2=CN=C3C(=N2)C(=NC(=N3)N)N |
Computed by PubChem (NCBI)