CAS 7420-89-5 appears in our catalog under these names: GLUTARALDEHYDE SODIUM BISULFITE ADDITION COMPOUND, Glutaraldehyde sodium bisulfite addition compound, GLUTARALDEHYDE SODIUM BISULFITE ADDITION. Offered by: GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 50g, 1kg, 2kg, 5kg, 10kg.
Disodium;1,5-dihydroxypentane-1,5-disulfonate (CAS 7420-89-5) is a chemical compound with the molecular formula C5H10Na2O8S2 and a molecular weight of 308.2 g/mol. IUPAC name: disodium;1,5-dihydroxypentane-1,5-disulfonate. InChIKey: YGZZDQOCTFVBFC-UHFFFAOYSA-L.
| Molecular formula | C5H10Na2O8S2 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | disodium;1,5-dihydroxypentane-1,5-disulfonate |
| InChIKey | YGZZDQOCTFVBFC-UHFFFAOYSA-L |
| SMILES | C(CC(O)S(=O)(=O)[O-])CC(O)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)