Products 742094-60-6

CAS 742094-60-6 is the registry number for ([(3-Nitro-4-pyrrolidin-1-ylphenyl)sulfonyl]amino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetic acid (CAS 742094-60-6) is a chemical compound with the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. IUPAC name: 2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetic acid. InChIKey: QRJVNKHBCYPSLO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15N3O6S
Molecular weight329.33 g/mol
IUPAC name2-[(3-nitro-4-pyrrolidin-1-ylphenyl)sulfonylamino]acetic acid
InChIKeyQRJVNKHBCYPSLO-UHFFFAOYSA-N
SMILESC1CCN(C1)C2=C(C=C(C=C2)S(=O)(=O)NCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)