CAS 742103-27-1 appears in our catalog under these names: cBRIDP, 96%, cBRIDP, cBRIDP 98%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
Ditert-butyl-(1-methyl-2,2-diphenylcyclopropyl)phosphane (CAS 742103-27-1) is a chemical compound with the molecular formula C24H33P and a molecular weight of 352.5 g/mol. IUPAC name: ditert-butyl-(1-methyl-2,2-diphenylcyclopropyl)phosphane. InChIKey: QMLPJDVGNRHGJQ-UHFFFAOYSA-N.
| Molecular formula | C24H33P |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | ditert-butyl-(1-methyl-2,2-diphenylcyclopropyl)phosphane |
| InChIKey | QMLPJDVGNRHGJQ-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=CC=C2)C3=CC=CC=C3)P(C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)