Products 742104-71-8

CAS 742104-71-8 is the registry number for 1,4-Dichloro-2-[(2-chloroethyl)sulfanyl]benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.

Structural formula: {0} (CAS {1})

1,4-dichloro-2-(2-chloroethylsulfanyl)benzene (CAS 742104-71-8) is a chemical compound with the molecular formula C8H7Cl3S and a molecular weight of 241.6 g/mol. IUPAC name: 1,4-dichloro-2-(2-chloroethylsulfanyl)benzene. InChIKey: HYFSHARHKLFQTF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Cl3S
Molecular weight241.6 g/mol
IUPAC name1,4-dichloro-2-(2-chloroethylsulfanyl)benzene
InChIKeyHYFSHARHKLFQTF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)SCCCl)Cl

Computed by PubChem (NCBI)