CAS 74228-25-4 appears in our catalog under these names: 3–(dicyanomethylidene)–2,3–dihydrobenzothiophene–1,1–dioxide, 3-(Dicyanomethylene)-2,3-dihydrobenzothiophene-1,1-dioxide, 99%, 99%, 2-(1,1-Dioxidobenzo[b]thiophen-3(2H)-ylidene)malononitrile, 99%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-(1,1-dioxo-1-benzothiophen-3-ylidene)propanedinitrile (CAS 74228-25-4) is a chemical compound with the molecular formula C11H6N2O2S and a molecular weight of 230.24 g/mol. IUPAC name: 2-(1,1-dioxo-1-benzothiophen-3-ylidene)propanedinitrile. InChIKey: MIBIVAHVPBKGES-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O2S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-(1,1-dioxo-1-benzothiophen-3-ylidene)propanedinitrile |
| InChIKey | MIBIVAHVPBKGES-UHFFFAOYSA-N |
| SMILES | C1C(=C(C#N)C#N)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)