Products 74239-84-2
CAS 74239-84-2 is the registry number for Baogongteng A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, Get quote.
[(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]octan-6-yl] acetate (CAS 74239-84-2) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: [(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]octan-6-yl] acetate. InChIKey: FSXBMHMVOFJROW-HXFLIBJXSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | [(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]octan-6-yl] acetate |
| InChIKey | FSXBMHMVOFJROW-HXFLIBJXSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H]2[C@H](CC[C@H]1N2)O |
Computed by PubChem (NCBI)
Synonyms:
Bao gong teng A, Baogongteng a, Erycibe alkaloid II, [(1R,2S,5R,6S)-2-hydroxy-8-azabicyclo[3.2.1]octan-6-yl] acetate, 8-Azabicyclo(3.2.1)octane-3,6-diol, 6-acetate, (exo,exo)-(-)-, ((1R,2S,5R,6S)-2-hydroxy-8-azabicyclo(3.2.1)octan-6-yl) acetate, BGT-A, orb1992322, 2-hydroxy-8-azabicyclo[3.2.1]octan-6-yl acetate