CAS 7424-72-8 appears in our catalog under these names: 9-(2-Naphthyl)anthracene, 95%, 9–(Naphthalen–2–yl)anthracene, 9-(2-Naphthyl)anthracene, >98.0%(GC), 9-(Naphthalen-2-Yl)Anthracene, 98%, 98%, 9-(Naphthalen-2-yl)anthracene. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 50g, 25g, 100g.
9-naphthalen-2-ylanthracene (CAS 7424-72-8) is a chemical compound with the molecular formula C24H16 and a molecular weight of 304.4 g/mol. IUPAC name: 9-naphthalen-2-ylanthracene. InChIKey: MFDORGWIGJJZEQ-UHFFFAOYSA-N.
| Molecular formula | C24H16 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 9-naphthalen-2-ylanthracene |
| InChIKey | MFDORGWIGJJZEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=CC5=CC=CC=C53 |
Computed by PubChem (NCBI)