CAS 74252-25-8 appears in our catalog under these names: Indomethacin sodium hydrate/ 99.45% (existing batch purity), Indomethacin sodium hydrate, 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-, sodium salt, hydrate (1:1:3), Indomethacin (sodium hydrate), 99.85%, Indomethacin (sodium hydrate) (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 500mg, 10mM (in 1ml dmso), 500g, 5g, 25g, 100g, 500 mg.
Sodium 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 74252-25-8) is a chemical compound with the molecular formula C19H15ClNNaO4 and a molecular weight of 379.8 g/mol. IUPAC name: sodium 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: JMHRGKDWGWORNU-UHFFFAOYSA-M.
| Molecular formula | C19H15ClNNaO4 |
|---|---|
| Molecular weight | 379.8 g/mol |
| IUPAC name | sodium 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | JMHRGKDWGWORNU-UHFFFAOYSA-M |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)