Products 74272-16-5
CAS 74272-16-5 is the registry number for trans-1,2,3,3a,7,7a-Hexahydro-4H-inden-4-one. Offered by: TRC. Available pack sizes: 500mg.
(3aS,7aR)-1,2,3,3a,7,7a-hexahydroinden-4-one (CAS 74272-16-5) is a chemical compound with the molecular formula C9H12O and a molecular weight of 136.19 g/mol. IUPAC name: (3aS,7aR)-1,2,3,3a,7,7a-hexahydroinden-4-one. InChIKey: OKCHLOVXYNLZAW-SFYZADRCSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (3aS,7aR)-1,2,3,3a,7,7a-hexahydroinden-4-one |
| InChIKey | OKCHLOVXYNLZAW-SFYZADRCSA-N |
| SMILES | C1C[C@@H]2CC=CC(=O)[C@H]2C1 |
Computed by PubChem (NCBI)