Products 743444-73-7
CAS 743444-73-7 appears in our catalog under these names: 2-Chloro-n-(1-cyano-1,2-dimethylpropyl)propanamide, 95%, 2-Chloro-N-(1-cyano-1,2-dimethylpropyl)propanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-chloro-N-(2-cyano-3-methylbutan-2-yl)propanamide (CAS 743444-73-7) is a chemical compound with the molecular formula C9H15ClN2O and a molecular weight of 202.68 g/mol. IUPAC name: 2-chloro-N-(2-cyano-3-methylbutan-2-yl)propanamide. InChIKey: QGQFQOZYPDIRQG-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 2-chloro-N-(2-cyano-3-methylbutan-2-yl)propanamide |
| InChIKey | QGQFQOZYPDIRQG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C#N)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)